C15H29F — CID 144971037
ethane;2-fluoro-1,4-dimethylbenzene;propane (PubChem CID 144971037) has the molecular formula C15H29F and a molecular weight of 228.39 g/mol. Its IUPAC name is ethane;2-fluoro-1,4-dimethylbenzene;propane.
| Compound Name | ethane;2-fluoro-1,4-dimethylbenzene;propane |
|---|---|
| PubChem CID | 144971037 |
| Molecular Formula | C15H29F |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | ethane;2-fluoro-1,4-dimethylbenzene;propane |
| SMILES | CC.CC.CCC.Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C8H9F.C3H8.2C2H6/c1-6-3-4-7(2)8(9)5-6;1-3-2;2*1-2/h3-5H,1-2H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | XOYXTWMADYURCO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |