C11H18FNO — CID 143812517
ethane;1-fluoro-2,4-dimethylbenzene;formamide (PubChem CID 143812517) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is ethane;1-fluoro-2,4-dimethylbenzene;formamide.
| Compound Name | ethane;1-fluoro-2,4-dimethylbenzene;formamide |
|---|---|
| PubChem CID | 143812517 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | ethane;1-fluoro-2,4-dimethylbenzene;formamide |
| SMILES | CC.Cc1ccc(F)c(C)c1.NC=O |
| InChI | InChI=1S/C8H9F.C2H6.CH3NO/c1-6-3-4-8(9)7(2)5-6;1-2;2-1-3/h3-5H,1-2H3;1-2H3;1H,(H2,2,3) |
| InChIKey | BAHYHNGHECLQEV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|