C17H31F — CID 142361482
ethane;1-fluoro-2,4-dimethylbenzene;2-methylhexane (PubChem CID 142361482) has the molecular formula C17H31F and a molecular weight of 254.43 g/mol. Its IUPAC name is ethane;1-fluoro-2,4-dimethylbenzene;2-methylhexane.
| Compound Name | ethane;1-fluoro-2,4-dimethylbenzene;2-methylhexane |
|---|---|
| PubChem CID | 142361482 |
| Molecular Formula | C17H31F |
| Molecular Weight | 254.43 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | ethane;1-fluoro-2,4-dimethylbenzene;2-methylhexane |
| SMILES | CC.CCCCC(C)C.Cc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C8H9F.C7H16.C2H6/c1-6-3-4-8(9)7(2)5-6;1-4-5-6-7(2)3;1-2/h3-5H,1-2H3;7H,4-6H2,1-3H3;1-2H3 |
| InChIKey | JIEUIZGELIGPPJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.43 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |