C12H21F — CID 123541236
ethane;1-fluoro-2,4-dimethylbenzene (PubChem CID 123541236) has the molecular formula C12H21F and a molecular weight of 184.30 g/mol. Its IUPAC name is ethane;1-fluoro-2,4-dimethylbenzene.
| Compound Name | ethane;1-fluoro-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 123541236 |
| Molecular Formula | C12H21F |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | ethane;1-fluoro-2,4-dimethylbenzene |
| SMILES | CC.CC.Cc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C8H9F.2C2H6/c1-6-3-4-8(9)7(2)5-6;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | QPLGOQOFMZMFOF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |