C8H11F2N — CID 142872799
1,2-difluoro-4-methylbenzene;methanamine (PubChem CID 142872799) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is 1,2-difluoro-4-methylbenzene;methanamine.
| Compound Name | 1,2-difluoro-4-methylbenzene;methanamine |
|---|---|
| PubChem CID | 142872799 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1,2-difluoro-4-methylbenzene;methanamine |
| SMILES | CN.Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C7H6F2.CH5N/c1-5-2-3-6(8)7(9)4-5;1-2/h2-4H,1H3;2H2,1H3 |
| InChIKey | FYVGEMYRWDGAOD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |