About ethane;4-fluoro-3-methylaniline
ethane;4-fluoro-3-methylaniline (PubChem CID 142250330) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is ethane;4-fluoro-3-methylaniline.
Molecular Properties
| Compound Name | ethane;4-fluoro-3-methylaniline |
| PubChem CID | 142250330 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | ethane;4-fluoro-3-methylaniline |
| SMILES | CC.Cc1cc(N)ccc1F |
| InChI | InChI=1S/C7H8FN.C2H6/c1-5-4-6(9)2-3-7(5)8;1-2/h2-4H,9H2,1H3;1-2H3 |
| InChIKey | AQRULZPUMOKGAH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-fluoro-3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-fluoro-3-methylaniline?
The IUPAC name of ethane;4-fluoro-3-methylaniline (CID 142250330) is ethane;4-fluoro-3-methylaniline.
What is the SMILES notation for ethane;4-fluoro-3-methylaniline?
The canonical SMILES for ethane;4-fluoro-3-methylaniline is CC.Cc1cc(N)ccc1F.
What is the InChIKey of ethane;4-fluoro-3-methylaniline?
The InChIKey is AQRULZPUMOKGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN.C2H6/c1-5-4-6(9)2-3-7(5)8;1-2/h2-4H,9H2,1H3;1-2H3.
What are the key properties of ethane;4-fluoro-3-methylaniline?
ethane;4-fluoro-3-methylaniline has a molecular weight of 155.22 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-fluoro-3-methylaniline is sourced from PubChem (CID 142250330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).