C14H14FN — CID 39243567
4-[(4-fluoro-3-methylphenyl)methyl]aniline (PubChem CID 39243567) has the molecular formula C14H14FN and a molecular weight of 215.27 g/mol. Its IUPAC name is 4-[(4-fluoro-3-methylphenyl)methyl]aniline.
| Compound Name | 4-[(4-fluoro-3-methylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 39243567 |
| Molecular Formula | C14H14FN |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-[(4-fluoro-3-methylphenyl)methyl]aniline |
| SMILES | Cc1cc(Cc2ccc(N)cc2)ccc1F |
| InChI | InChI=1S/C14H14FN/c1-10-8-12(4-7-14(10)15)9-11-2-5-13(16)6-3-11/h2-8H,9,16H2,1H3 |
| InChIKey | FTSQLYOVMHSHFP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|