C14H17N3 — CID 3020827
5-[(4-aminophenyl)methyl]-2-methylbenzene-1,3-diamine (PubChem CID 3020827) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-[(4-aminophenyl)methyl]-2-methylbenzene-1,3-diamine.
| Compound Name | 5-[(4-aminophenyl)methyl]-2-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 3020827 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-[(4-aminophenyl)methyl]-2-methylbenzene-1,3-diamine |
| SMILES | Cc1c(N)cc(Cc2ccc(N)cc2)cc1N |
| InChI | InChI=1S/C14H17N3/c1-9-13(16)7-11(8-14(9)17)6-10-2-4-12(15)5-3-10/h2-5,7-8H,6,15-17H2,1H3 |
| InChIKey | SJRPHAACXLIGMI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|