About 4-[(4-aminophenyl)methyl]aniline;hydrazine
4-[(4-aminophenyl)methyl]aniline;hydrazine (PubChem CID 70467747) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;hydrazine.
Molecular Properties
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;hydrazine |
| PubChem CID | 70467747 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;hydrazine |
| SMILES | NN.Nc1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H14N2.H4N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;1-2/h1-8H,9,14-15H2;1-2H2 |
| InChIKey | FEYXKTAKAFNQIU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-aminophenyl)methyl]aniline;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-aminophenyl)methyl]aniline;hydrazine?
The IUPAC name of 4-[(4-aminophenyl)methyl]aniline;hydrazine (CID 70467747) is 4-[(4-aminophenyl)methyl]aniline;hydrazine.
What is the SMILES notation for 4-[(4-aminophenyl)methyl]aniline;hydrazine?
The canonical SMILES for 4-[(4-aminophenyl)methyl]aniline;hydrazine is NN.Nc1ccc(Cc2ccc(N)cc2)cc1.
What is the InChIKey of 4-[(4-aminophenyl)methyl]aniline;hydrazine?
The InChIKey is FEYXKTAKAFNQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2.H4N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;1-2/h1-8H,9,14-15H2;1-2H2.
What are the key properties of 4-[(4-aminophenyl)methyl]aniline;hydrazine?
4-[(4-aminophenyl)methyl]aniline;hydrazine has a molecular weight of 230.31 g/mol, XLogP of 1.26, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-aminophenyl)methyl]aniline;hydrazine is sourced from PubChem (CID 70467747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).