C7H12N2S — CID 174900310
2-methylbenzene-1,4-diamine;sulfane (PubChem CID 174900310) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 2-methylbenzene-1,4-diamine;sulfane.
| Compound Name | 2-methylbenzene-1,4-diamine;sulfane |
|---|---|
| PubChem CID | 174900310 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-methylbenzene-1,4-diamine;sulfane |
| SMILES | Cc1cc(N)ccc1N.S |
| InChI | InChI=1S/C7H10N2.H2S/c1-5-4-6(8)2-3-7(5)9;/h2-4H,8-9H2,1H3;1H2 |
| InChIKey | DKUGOQRWNDKJQB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|