C7H9IN2 — CID 163574989
1-N-iodo-2-methylbenzene-1,4-diamine (PubChem CID 163574989) has the molecular formula C7H9IN2 and a molecular weight of 248.07 g/mol. Its IUPAC name is 1-N-iodo-2-methylbenzene-1,4-diamine.
| Compound Name | 1-N-iodo-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 163574989 |
| Molecular Formula | C7H9IN2 |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 1-N-iodo-2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1NI |
| InChI | InChI=1S/C7H9IN2/c1-5-4-6(9)2-3-7(5)10-8/h2-4,10H,9H2,1H3 |
| InChIKey | GCRRYVDZCYKWHO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|