About 4-aminophenol;2-methylbenzene-1,4-diamine
4-aminophenol;2-methylbenzene-1,4-diamine (PubChem CID 160894868) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-aminophenol;2-methylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-aminophenol;2-methylbenzene-1,4-diamine |
| PubChem CID | 160894868 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-aminophenol;2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1N.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C7H10N2.C6H7NO/c1-5-4-6(8)2-3-7(5)9;7-5-1-3-6(8)4-2-5/h2-4H,8-9H2,1H3;1-4,8H,7H2 |
| InChIKey | SOSUSMOLFSOZRH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-aminophenol;2-methylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminophenol;2-methylbenzene-1,4-diamine?
The IUPAC name of 4-aminophenol;2-methylbenzene-1,4-diamine (CID 160894868) is 4-aminophenol;2-methylbenzene-1,4-diamine.
What is the SMILES notation for 4-aminophenol;2-methylbenzene-1,4-diamine?
The canonical SMILES for 4-aminophenol;2-methylbenzene-1,4-diamine is Cc1cc(N)ccc1N.Nc1ccc(O)cc1.
What is the InChIKey of 4-aminophenol;2-methylbenzene-1,4-diamine?
The InChIKey is SOSUSMOLFSOZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C6H7NO/c1-5-4-6(8)2-3-7(5)9;7-5-1-3-6(8)4-2-5/h2-4H,8-9H2,1H3;1-4,8H,7H2.
What are the key properties of 4-aminophenol;2-methylbenzene-1,4-diamine?
4-aminophenol;2-methylbenzene-1,4-diamine has a molecular weight of 231.30 g/mol, XLogP of 2.13, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminophenol;2-methylbenzene-1,4-diamine is sourced from PubChem (CID 160894868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).