C13H17N3O — CID 160894868
4-aminophenol;2-methylbenzene-1,4-diamine (PubChem CID 160894868) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-aminophenol;2-methylbenzene-1,4-diamine.
| Compound Name | 4-aminophenol;2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 160894868 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-aminophenol;2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1N.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C7H10N2.C6H7NO/c1-5-4-6(8)2-3-7(5)9;7-5-1-3-6(8)4-2-5/h2-4H,8-9H2,1H3;1-4,8H,7H2 |
| InChIKey | SOSUSMOLFSOZRH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|