About 4-amino-3-methylphenol;4-(methylamino)phenol
4-amino-3-methylphenol;4-(methylamino)phenol (PubChem CID 69014448) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-amino-3-methylphenol;4-(methylamino)phenol.
Molecular Properties
| Compound Name | 4-amino-3-methylphenol;4-(methylamino)phenol |
| PubChem CID | 69014448 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-amino-3-methylphenol;4-(methylamino)phenol |
| SMILES | CNc1ccc(O)cc1.Cc1cc(O)ccc1N |
| InChI | InChI=1S/2C7H9NO/c1-8-6-2-4-7(9)5-3-6;1-5-4-6(9)2-3-7(5)8/h2-5,8-9H,1H3;2-4,9H,8H2,1H3 |
| InChIKey | GIJCQZPNLHKOSJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-methylphenol;4-(methylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-methylphenol;4-(methylamino)phenol?
The IUPAC name of 4-amino-3-methylphenol;4-(methylamino)phenol (CID 69014448) is 4-amino-3-methylphenol;4-(methylamino)phenol.
What is the SMILES notation for 4-amino-3-methylphenol;4-(methylamino)phenol?
The canonical SMILES for 4-amino-3-methylphenol;4-(methylamino)phenol is CNc1ccc(O)cc1.Cc1cc(O)ccc1N.
What is the InChIKey of 4-amino-3-methylphenol;4-(methylamino)phenol?
The InChIKey is GIJCQZPNLHKOSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H9NO/c1-8-6-2-4-7(9)5-3-6;1-5-4-6(9)2-3-7(5)8/h2-5,8-9H,1H3;2-4,9H,8H2,1H3.
What are the key properties of 4-amino-3-methylphenol;4-(methylamino)phenol?
4-amino-3-methylphenol;4-(methylamino)phenol has a molecular weight of 246.31 g/mol, XLogP of 2.72, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-methylphenol;4-(methylamino)phenol is sourced from PubChem (CID 69014448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).