About 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene
4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene (PubChem CID 143014115) has the molecular formula C21H23NO
and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene.
Molecular Properties
| Compound Name | 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene |
| PubChem CID | 143014115 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene |
| SMILES | CNc1ccc(O)cc1.Cc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14.C7H9NO/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-8-6-2-4-7(9)5-3-6/h3-10H,1-2H3;2-5,8-9H,1H3 |
| InChIKey | QCNYDNWAULSVOT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene?
The IUPAC name of 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene (CID 143014115) is 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene.
What is the SMILES notation for 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene?
The canonical SMILES for 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene is CNc1ccc(O)cc1.Cc1ccc(-c2ccc(C)cc2)cc1.
What is the InChIKey of 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene?
The InChIKey is QCNYDNWAULSVOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C7H9NO/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-8-6-2-4-7(9)5-3-6/h3-10H,1-2H3;2-5,8-9H,1H3.
What are the key properties of 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene?
4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene has a molecular weight of 305.42 g/mol, XLogP of 5.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)phenol;1-methyl-4-(4-methylphenyl)benzene is sourced from PubChem (CID 143014115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).