C9H15N — CID 159702289
N,4-dimethylaniline;methane (PubChem CID 159702289) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N,4-dimethylaniline;methane.
| Compound Name | N,4-dimethylaniline;methane |
|---|---|
| PubChem CID | 159702289 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N,4-dimethylaniline;methane |
| SMILES | C.CNc1ccc(C)cc1 |
| InChI | InChI=1S/C8H11N.CH4/c1-7-3-5-8(9-2)6-4-7;/h3-6,9H,1-2H3;1H4 |
| InChIKey | MXTVUAXSAAHQRM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |