About N,4-dimethylaniline;1-ethenyl-3-methylbenzene
N,4-dimethylaniline;1-ethenyl-3-methylbenzene (PubChem CID 142013646) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is N,4-dimethylaniline;1-ethenyl-3-methylbenzene.
Molecular Properties
| Compound Name | N,4-dimethylaniline;1-ethenyl-3-methylbenzene |
| PubChem CID | 142013646 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N,4-dimethylaniline;1-ethenyl-3-methylbenzene |
| SMILES | C=Cc1cccc(C)c1.CNc1ccc(C)cc1 |
| InChI | InChI=1S/C9H10.C8H11N/c1-3-9-6-4-5-8(2)7-9;1-7-3-5-8(9-2)6-4-7/h3-7H,1H2,2H3;3-6,9H,1-2H3 |
| InChIKey | DQNWYTGCBRPPBM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,4-dimethylaniline;1-ethenyl-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethylaniline;1-ethenyl-3-methylbenzene?
The IUPAC name of N,4-dimethylaniline;1-ethenyl-3-methylbenzene (CID 142013646) is N,4-dimethylaniline;1-ethenyl-3-methylbenzene.
What is the SMILES notation for N,4-dimethylaniline;1-ethenyl-3-methylbenzene?
The canonical SMILES for N,4-dimethylaniline;1-ethenyl-3-methylbenzene is C=Cc1cccc(C)c1.CNc1ccc(C)cc1.
What is the InChIKey of N,4-dimethylaniline;1-ethenyl-3-methylbenzene?
The InChIKey is DQNWYTGCBRPPBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C8H11N/c1-3-9-6-4-5-8(2)7-9;1-7-3-5-8(9-2)6-4-7/h3-7H,1H2,2H3;3-6,9H,1-2H3.
What are the key properties of N,4-dimethylaniline;1-ethenyl-3-methylbenzene?
N,4-dimethylaniline;1-ethenyl-3-methylbenzene has a molecular weight of 239.36 g/mol, XLogP of 4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethylaniline;1-ethenyl-3-methylbenzene is sourced from PubChem (CID 142013646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).