C22H21N — CID 69459469
N-(4-ethenylphenyl)-3-methyl-N-(4-methylphenyl)aniline (PubChem CID 69459469) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(4-ethenylphenyl)-3-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-(4-ethenylphenyl)-3-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 69459469 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-(4-ethenylphenyl)-3-methyl-N-(4-methylphenyl)aniline |
| SMILES | C=Cc1ccc(N(c2ccc(C)cc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C22H21N/c1-4-19-10-14-21(15-11-19)23(20-12-8-17(2)9-13-20)22-7-5-6-18(3)16-22/h4-16H,1H2,2-3H3 |
| InChIKey | YFPCVNQLMBXVRE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |