C40H34N2 — CID 21044922
N-[4-[4-(4-ethenyl-N-(3-methylphenyl)anilino)phenyl]phenyl]-3-methyl-N-phenylaniline (PubChem CID 21044922) has the molecular formula C40H34N2 and a molecular weight of 542.73 g/mol. Its IUPAC name is N-[4-[4-(4-ethenyl-N-(3-methylphenyl)anilino)phenyl]phenyl]-3-methyl-N-phenylaniline.
| Compound Name | N-[4-[4-(4-ethenyl-N-(3-methylphenyl)anilino)phenyl]phenyl]-3-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 21044922 |
| Molecular Formula | C40H34N2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | N-[4-[4-(4-ethenyl-N-(3-methylphenyl)anilino)phenyl]phenyl]-3-methyl-N-phenylaniline |
| SMILES | C=Cc1ccc(N(c2ccc(-c3ccc(N(c4ccccc4)c4cccc(C)c4)cc3)cc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C40H34N2/c1-4-32-16-22-36(23-17-32)42(40-15-9-11-31(3)29-40)38-26-20-34(21-27-38)33-18-24-37(25-19-33)41(35-12-6-5-7-13-35)39-14-8-10-30(2)28-39/h4-29H,1H2,2-3H3 |
| InChIKey | SDFBCGIQDKOYRX-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |