C10H17N — CID 90758225
N,4-dimethylaniline;ethane (PubChem CID 90758225) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N,4-dimethylaniline;ethane.
| Compound Name | N,4-dimethylaniline;ethane |
|---|---|
| PubChem CID | 90758225 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N,4-dimethylaniline;ethane |
| SMILES | CC.CNc1ccc(C)cc1 |
| InChI | InChI=1S/C8H11N.C2H6/c1-7-3-5-8(9-2)6-4-7;1-2/h3-6,9H,1-2H3;1-2H3 |
| InChIKey | QYQYPVMUYBKQLM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |