C26H33N3S — CID 158414856
2,5-dimethyl-1H-pyrrole;2,5-dimethylthiophene;1-N-methyl-4-N-(4-methylphenyl)benzene-1,4-diamine (PubChem CID 158414856) has the molecular formula C26H33N3S and a molecular weight of 419.64 g/mol. Its IUPAC name is 2,5-dimethyl-1H-pyrrole;2,5-dimethylthiophene;1-N-methyl-4-N-(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | 2,5-dimethyl-1H-pyrrole;2,5-dimethylthiophene;1-N-methyl-4-N-(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 158414856 |
| Molecular Formula | C26H33N3S |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 2,5-dimethyl-1H-pyrrole;2,5-dimethylthiophene;1-N-methyl-4-N-(4-methylphenyl)benzene-1,4-diamine |
| SMILES | CNc1ccc(Nc2ccc(C)cc2)cc1.Cc1ccc(C)[nH]1.Cc1ccc(C)s1 |
| InChI | InChI=1S/C14H16N2.C6H9N.C6H8S/c1-11-3-5-13(6-4-11)16-14-9-7-12(15-2)8-10-14;2*1-5-3-4-6(2)7-5/h3-10,15-16H,1-2H3;3-4,7H,1-2H3;3-4H,1-2H3 |
| InChIKey | GZTKHPFKNHKXGI-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|