C18H28N2 — CID 91075726
ethane;1-N-methyl-4-N-(4-methylphenyl)benzene-1,4-diamine (PubChem CID 91075726) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is ethane;1-N-methyl-4-N-(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | ethane;1-N-methyl-4-N-(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 91075726 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | ethane;1-N-methyl-4-N-(4-methylphenyl)benzene-1,4-diamine |
| SMILES | CC.CC.CNc1ccc(Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H16N2.2C2H6/c1-11-3-5-13(6-4-11)16-14-9-7-12(15-2)8-10-14;2*1-2/h3-10,15-16H,1-2H3;2*1-2H3 |
| InChIKey | DSBQHGHVDYWYJV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|