C28H34N4 — CID 143782226
methane;1-N-methyl-4-N-[4-[4-(4-methylanilino)anilino]phenyl]benzene-1,4-diamine (PubChem CID 143782226) has the molecular formula C28H34N4 and a molecular weight of 426.61 g/mol. Its IUPAC name is methane;1-N-methyl-4-N-[4-[4-(4-methylanilino)anilino]phenyl]benzene-1,4-diamine.
| Compound Name | methane;1-N-methyl-4-N-[4-[4-(4-methylanilino)anilino]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 143782226 |
| Molecular Formula | C28H34N4 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | methane;1-N-methyl-4-N-[4-[4-(4-methylanilino)anilino]phenyl]benzene-1,4-diamine |
| SMILES | C.C.CNc1ccc(Nc2ccc(Nc3ccc(Nc4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4.2CH4/c1-19-3-5-21(6-4-19)28-23-11-13-25(14-12-23)30-26-17-15-24(16-18-26)29-22-9-7-20(27-2)8-10-22;;/h3-18,27-30H,1-2H3;2*1H4 |
| InChIKey | OKEYFPOLYUBCCG-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|