About 4-methyl-N-(4-methylphenyl)aniline;naphthalene
4-methyl-N-(4-methylphenyl)aniline;naphthalene (PubChem CID 174486958) has the molecular formula C24H23N
and a molecular weight of 325.46 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)aniline;naphthalene.
Molecular Properties
| Compound Name | 4-methyl-N-(4-methylphenyl)aniline;naphthalene |
| PubChem CID | 174486958 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)aniline;naphthalene |
| SMILES | Cc1ccc(Nc2ccc(C)cc2)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H15N.C10H8/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-2-6-10-8-4-3-7-9(10)5-1/h3-10,15H,1-2H3;1-8H |
| InChIKey | ZRLKYHWUPXPWEE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-N-(4-methylphenyl)aniline;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(4-methylphenyl)aniline;naphthalene?
The IUPAC name of 4-methyl-N-(4-methylphenyl)aniline;naphthalene (CID 174486958) is 4-methyl-N-(4-methylphenyl)aniline;naphthalene.
What is the SMILES notation for 4-methyl-N-(4-methylphenyl)aniline;naphthalene?
The canonical SMILES for 4-methyl-N-(4-methylphenyl)aniline;naphthalene is Cc1ccc(Nc2ccc(C)cc2)cc1.c1ccc2ccccc2c1.
What is the InChIKey of 4-methyl-N-(4-methylphenyl)aniline;naphthalene?
The InChIKey is ZRLKYHWUPXPWEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.C10H8/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-2-6-10-8-4-3-7-9(10)5-1/h3-10,15H,1-2H3;1-8H.
What are the key properties of 4-methyl-N-(4-methylphenyl)aniline;naphthalene?
4-methyl-N-(4-methylphenyl)aniline;naphthalene has a molecular weight of 325.46 g/mol, XLogP of 6.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(4-methylphenyl)aniline;naphthalene is sourced from PubChem (CID 174486958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).