About ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene
ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene (PubChem CID 144508046) has the molecular formula C23H29NO
and a molecular weight of 335.49 g/mol. Its IUPAC name is ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene.
Molecular Properties
| Compound Name | ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene |
| PubChem CID | 144508046 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene |
| SMILES | CC.CNc1ccc(Oc2ccc(C)cc2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C14H15NO.C7H8.C2H6/c1-11-3-7-13(8-4-11)16-14-9-5-12(15-2)6-10-14;1-7-5-3-2-4-6-7;1-2/h3-10,15H,1-2H3;2-6H,1H3;1-2H3 |
| InChIKey | DPGAYVWDBVWCMK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene?
The IUPAC name of ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene (CID 144508046) is ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene.
What is the SMILES notation for ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene?
The canonical SMILES for ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene is CC.CNc1ccc(Oc2ccc(C)cc2)cc1.Cc1ccccc1.
What is the InChIKey of ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene?
The InChIKey is DPGAYVWDBVWCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO.C7H8.C2H6/c1-11-3-7-13(8-4-11)16-14-9-5-12(15-2)6-10-14;1-7-5-3-2-4-6-7;1-2/h3-10,15H,1-2H3;2-6H,1H3;1-2H3.
What are the key properties of ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene?
ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene has a molecular weight of 335.49 g/mol, XLogP of 6.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-4-(4-methylphenoxy)aniline;toluene is sourced from PubChem (CID 144508046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).