About ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene
ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene (PubChem CID 142829586) has the molecular formula C30H36O
and a molecular weight of 412.62 g/mol. Its IUPAC name is ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene.
Molecular Properties
| Compound Name | ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene |
| PubChem CID | 142829586 |
| Molecular Formula | C30H36O |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene |
| SMILES | CC.CC.Cc1ccc(-c2ccc(C)cc2)cc1.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C12H10O.2C2H6/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-2/h3-10H,1-2H3;1-10H;2*1-2H3 |
| InChIKey | PQUZQBVCDYOIMX-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene?
The IUPAC name of ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene (CID 142829586) is ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene.
What is the SMILES notation for ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene?
The canonical SMILES for ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene is CC.CC.Cc1ccc(-c2ccc(C)cc2)cc1.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene?
The InChIKey is PQUZQBVCDYOIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C12H10O.2C2H6/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-2/h3-10H,1-2H3;1-10H;2*1-2H3.
What are the key properties of ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene?
ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene has a molecular weight of 412.62 g/mol, XLogP of 9.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-(4-methylphenyl)benzene;phenoxybenzene is sourced from PubChem (CID 142829586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).