C56H46O — CID 58942110
1-[2,2-bis(4-methylphenyl)-1-[4-[4-[(Z)-2-(4-methylphenyl)-1,2-diphenylethenyl]phenoxy]phenyl]ethenyl]-4-methylbenzene (PubChem CID 58942110) has the molecular formula C56H46O and a molecular weight of 734.98 g/mol. Its IUPAC name is 1-[2,2-bis(4-methylphenyl)-1-[4-[4-[(Z)-2-(4-methylphenyl)-1,2-diphenylethenyl]phenoxy]phenyl]ethenyl]-4-methylbenzene.
| Compound Name | 1-[2,2-bis(4-methylphenyl)-1-[4-[4-[(Z)-2-(4-methylphenyl)-1,2-diphenylethenyl]phenoxy]phenyl]ethenyl]-4-methylbenzene |
|---|---|
| PubChem CID | 58942110 |
| Molecular Formula | C56H46O |
| Molecular Weight | 734.98 g/mol |
| Exact Mass | 734.35 |
| IUPAC Name | 1-[2,2-bis(4-methylphenyl)-1-[4-[4-[(Z)-2-(4-methylphenyl)-1,2-diphenylethenyl]phenoxy]phenyl]ethenyl]-4-methylbenzene |
| SMILES | Cc1ccc(C(=C(c2ccc(C)cc2)c2ccc(Oc3ccc(/C(=C(/c4ccccc4)c4ccc(C)cc4)c4ccccc4)cc3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C56H46O/c1-39-15-23-45(24-16-39)53(43-11-7-5-8-12-43)54(44-13-9-6-10-14-44)49-31-35-51(36-32-49)57-52-37-33-50(34-38-52)56(48-29-21-42(4)22-30-48)55(46-25-17-40(2)18-26-46)47-27-19-41(3)20-28-47/h5-38H,1-4H3/b54-53- |
| InChIKey | VDANELFPJOYOHZ-QOLNFUTBSA-N |
| XLogP | 14.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.98 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|