C87H66 — CID 170669630
1,3,5-tris[4-[(E)-2-(4-methylphenyl)-1,2-diphenylethenyl]phenyl]benzene (PubChem CID 170669630) has the molecular formula C87H66 and a molecular weight of 1111.48 g/mol. Its IUPAC name is 1,3,5-tris[4-[(E)-2-(4-methylphenyl)-1,2-diphenylethenyl]phenyl]benzene.
| Compound Name | 1,3,5-tris[4-[(E)-2-(4-methylphenyl)-1,2-diphenylethenyl]phenyl]benzene |
|---|---|
| PubChem CID | 170669630 |
| Molecular Formula | C87H66 |
| Molecular Weight | 1111.48 g/mol |
| Exact Mass | 1110.52 |
| IUPAC Name | 1,3,5-tris[4-[(E)-2-(4-methylphenyl)-1,2-diphenylethenyl]phenyl]benzene |
| SMILES | Cc1ccc(/C(=C(\c2ccccc2)c2ccc(-c3cc(-c4ccc(/C(=C(\c5ccccc5)c5ccc(C)cc5)c5ccccc5)cc4)cc(-c4ccc(/C(=C(\c5ccccc5)c5ccc(C)cc5)c5ccccc5)cc4)c3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C87H66/c1-61-34-40-73(41-35-61)82(67-22-10-4-11-23-67)85(70-28-16-7-17-29-70)76-52-46-64(47-53-76)79-58-80(65-48-54-77(55-49-65)86(71-30-18-8-19-31-71)83(68-24-12-5-13-25-68)74-42-36-62(2)37-43-74)60-81(59-79)66-50-56-78(57-51-66)87(72-32-20-9-21-33-72)84(69-26-14-6-15-27-69)75-44-38-63(3)39-45-75/h4-60H,1-3H3/b85-82+,86-83+,87-84+ |
| InChIKey | IUKQUILLGPTHRS-RZUCKMDSSA-N |
| XLogP | 22.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1111.48 |
| LogP ≤ 5 | 22.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|