C28H24O2 — CID 71093796
3-[(E)-2-(3-hydroxyphenyl)-1,2-bis(4-methylphenyl)ethenyl]phenol (PubChem CID 71093796) has the molecular formula C28H24O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[(E)-2-(3-hydroxyphenyl)-1,2-bis(4-methylphenyl)ethenyl]phenol.
| Compound Name | 3-[(E)-2-(3-hydroxyphenyl)-1,2-bis(4-methylphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 71093796 |
| Molecular Formula | C28H24O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[(E)-2-(3-hydroxyphenyl)-1,2-bis(4-methylphenyl)ethenyl]phenol |
| SMILES | Cc1ccc(/C(=C(/c2ccc(C)cc2)c2cccc(O)c2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C28H24O2/c1-19-9-13-21(14-10-19)27(23-5-3-7-25(29)17-23)28(22-15-11-20(2)12-16-22)24-6-4-8-26(30)18-24/h3-18,29-30H,1-2H3/b28-27+ |
| InChIKey | TVINAEIWURDWIK-BYYHNAKLSA-N |
| XLogP | 6.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|