About 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone
2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone (PubChem CID 67836332) has the molecular formula C15H15BrO3
and a molecular weight of 323.19 g/mol. Its IUPAC name is 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone |
| PubChem CID | 67836332 |
| Molecular Formula | C15H15BrO3 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone |
| SMILES | CC(=O)c1cccc(O)c1.Cc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C8H8O2.C7H7BrO/c1-6(9)7-3-2-4-8(10)5-7;1-5-2-3-7(9)6(8)4-5/h2-5,10H,1H3;2-4,9H,1H3 |
| InChIKey | NPXVLKOAGJNJMW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone?
The IUPAC name of 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone (CID 67836332) is 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone.
What is the SMILES notation for 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone?
The canonical SMILES for 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone is CC(=O)c1cccc(O)c1.Cc1ccc(O)c(Br)c1.
What is the InChIKey of 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone?
The InChIKey is NPXVLKOAGJNJMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C7H7BrO/c1-6(9)7-3-2-4-8(10)5-7;1-5-2-3-7(9)6(8)4-5/h2-5,10H,1H3;2-4,9H,1H3.
What are the key properties of 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone?
2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone has a molecular weight of 323.19 g/mol, XLogP of 4.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methylphenol;1-(3-hydroxyphenyl)ethanone is sourced from PubChem (CID 67836332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).