About 2-hydroxy-5-methylbenzaldehyde;3-methylphenol
2-hydroxy-5-methylbenzaldehyde;3-methylphenol (PubChem CID 87684857) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-hydroxy-5-methylbenzaldehyde;3-methylphenol.
Molecular Properties
| Compound Name | 2-hydroxy-5-methylbenzaldehyde;3-methylphenol |
| PubChem CID | 87684857 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-hydroxy-5-methylbenzaldehyde;3-methylphenol |
| SMILES | Cc1ccc(O)c(C=O)c1.Cc1cccc(O)c1 |
| InChI | InChI=1S/C8H8O2.C7H8O/c1-6-2-3-8(10)7(4-6)5-9;1-6-3-2-4-7(8)5-6/h2-5,10H,1H3;2-5,8H,1H3 |
| InChIKey | PROMUFJOPSQZBT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-5-methylbenzaldehyde;3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-methylbenzaldehyde;3-methylphenol?
The IUPAC name of 2-hydroxy-5-methylbenzaldehyde;3-methylphenol (CID 87684857) is 2-hydroxy-5-methylbenzaldehyde;3-methylphenol.
What is the SMILES notation for 2-hydroxy-5-methylbenzaldehyde;3-methylphenol?
The canonical SMILES for 2-hydroxy-5-methylbenzaldehyde;3-methylphenol is Cc1ccc(O)c(C=O)c1.Cc1cccc(O)c1.
What is the InChIKey of 2-hydroxy-5-methylbenzaldehyde;3-methylphenol?
The InChIKey is PROMUFJOPSQZBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C7H8O/c1-6-2-3-8(10)7(4-6)5-9;1-6-3-2-4-7(8)5-6/h2-5,10H,1H3;2-5,8H,1H3.
What are the key properties of 2-hydroxy-5-methylbenzaldehyde;3-methylphenol?
2-hydroxy-5-methylbenzaldehyde;3-methylphenol has a molecular weight of 244.29 g/mol, XLogP of 3.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-methylbenzaldehyde;3-methylphenol is sourced from PubChem (CID 87684857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).