C14H14O4 — CID 175246423
benzene-1,2-diol;2-hydroxy-5-methylbenzaldehyde (PubChem CID 175246423) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is benzene-1,2-diol;2-hydroxy-5-methylbenzaldehyde.
| Compound Name | benzene-1,2-diol;2-hydroxy-5-methylbenzaldehyde |
|---|---|
| PubChem CID | 175246423 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | benzene-1,2-diol;2-hydroxy-5-methylbenzaldehyde |
| SMILES | Cc1ccc(O)c(C=O)c1.Oc1ccccc1O |
| InChI | InChI=1S/C8H8O2.C6H6O2/c1-6-2-3-8(10)7(4-6)5-9;7-5-3-1-2-4-6(5)8/h2-5,10H,1H3;1-4,7-8H |
| InChIKey | USYKFTPTCYXVNX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|