C15H14N2O2 — CID 136794282
5-[(2,4-dimethylphenyl)diazenyl]-2-hydroxybenzaldehyde (PubChem CID 136794282) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenyl)diazenyl]-2-hydroxybenzaldehyde.
| Compound Name | 5-[(2,4-dimethylphenyl)diazenyl]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 136794282 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-[(2,4-dimethylphenyl)diazenyl]-2-hydroxybenzaldehyde |
| SMILES | Cc1ccc(/N=N/c2ccc(O)c(C=O)c2)c(C)c1 |
| InChI | InChI=1S/C15H14N2O2/c1-10-3-5-14(11(2)7-10)17-16-13-4-6-15(19)12(8-13)9-18/h3-9,19H,1-2H3/b17-16+ |
| InChIKey | MNNVLCDRUHUEAH-WUKNDPDISA-N |
| XLogP | 4.24 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|