C28H26N4O2 — CID 136913309
4-[[4-[4-[(4-hydroxy-3-methylphenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-2-methylphenol (PubChem CID 136913309) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-[[4-[4-[(4-hydroxy-3-methylphenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-2-methylphenol.
| Compound Name | 4-[[4-[4-[(4-hydroxy-3-methylphenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-2-methylphenol |
|---|---|
| PubChem CID | 136913309 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 4-[[4-[4-[(4-hydroxy-3-methylphenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-2-methylphenol |
| SMILES | Cc1cc(/N=N/c2ccc(-c3ccc(/N=N/c4ccc(O)c(C)c4)c(C)c3)cc2C)ccc1O |
| InChI | InChI=1S/C28H26N4O2/c1-17-13-21(5-9-25(17)31-29-23-7-11-27(33)19(3)15-23)22-6-10-26(18(2)14-22)32-30-24-8-12-28(34)20(4)16-24/h5-16,33-34H,1-4H3/b31-29+,32-30+ |
| InChIKey | IWRGIBQUYWVUDM-JWTBXLROSA-N |
| XLogP | 8.83 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|