About 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine
2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine (PubChem CID 159049808) has the molecular formula C20H18I2N4O
and a molecular weight of 584.20 g/mol. Its IUPAC name is 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine.
Molecular Properties
| Compound Name | 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine |
| PubChem CID | 159049808 |
| Molecular Formula | C20H18I2N4O |
| Molecular Weight | 584.20 g/mol |
| Exact Mass | 583.96 |
| IUPAC Name | 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3ccc(O)c(C)c3)cc2)cc1.II |
| InChI | InChI=1S/C20H18N4O.I2/c1-14-3-5-16(6-4-14)21-22-17-7-9-18(10-8-17)23-24-19-11-12-20(25)15(2)13-19;1-2/h3-13,25H,1-2H3;/b22-21+,24-23+; |
| InChIKey | JXCVBSPUUQENJZ-HQHRKKNHSA-N |
| XLogP | 8.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.20 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine?
The IUPAC name of 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine (CID 159049808) is 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine.
What is the SMILES notation for 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine?
The canonical SMILES for 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine is Cc1ccc(/N=N/c2ccc(/N=N/c3ccc(O)c(C)c3)cc2)cc1.II.
What is the InChIKey of 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine?
The InChIKey is JXCVBSPUUQENJZ-HQHRKKNHSA-N. The full InChI is InChI=1S/C20H18N4O.I2/c1-14-3-5-16(6-4-14)21-22-17-7-9-18(10-8-17)23-24-19-11-12-20(25)15(2)13-19;1-2/h3-13,25H,1-2H3;/b22-21+,24-23+;.
What are the key properties of 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine?
2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine has a molecular weight of 584.20 g/mol, XLogP of 8.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenol;molecular iodine is sourced from PubChem (CID 159049808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).