C28H26N6O2 — CID 136901382
4-[[4-[[4-[(4-hydroxy-3,5-dimethylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-2,6-dimethylphenol (PubChem CID 136901382) has the molecular formula C28H26N6O2 and a molecular weight of 478.56 g/mol. Its IUPAC name is 4-[[4-[[4-[(4-hydroxy-3,5-dimethylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-2,6-dimethylphenol.
| Compound Name | 4-[[4-[[4-[(4-hydroxy-3,5-dimethylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 136901382 |
| Molecular Formula | C28H26N6O2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 4-[[4-[[4-[(4-hydroxy-3,5-dimethylphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4cc(C)c(O)c(C)c4)cc3)cc2)cc(C)c1O |
| InChI | InChI=1S/C28H26N6O2/c1-17-13-25(14-18(2)27(17)35)33-31-23-9-5-21(6-10-23)29-30-22-7-11-24(12-8-22)32-34-26-15-19(3)28(36)20(4)16-26/h5-16,35-36H,1-4H3/b30-29+,33-31+,34-32+ |
| InChIKey | PPLZZUUIYMGEEH-FSVBEFDCSA-N |
| XLogP | 9.58 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|