C14H12N4O5 — CID 136728959
4-[(2,4-dinitrophenyl)diazenyl]-2,6-dimethylphenol (PubChem CID 136728959) has the molecular formula C14H12N4O5 and a molecular weight of 316.27 g/mol. Its IUPAC name is 4-[(2,4-dinitrophenyl)diazenyl]-2,6-dimethylphenol.
| Compound Name | 4-[(2,4-dinitrophenyl)diazenyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 136728959 |
| Molecular Formula | C14H12N4O5 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-[(2,4-dinitrophenyl)diazenyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(C)c1O |
| InChI | InChI=1S/C14H12N4O5/c1-8-5-10(6-9(2)14(8)19)15-16-12-4-3-11(17(20)21)7-13(12)18(22)23/h3-7,19H,1-2H3/b16-15+ |
| InChIKey | POLFBRDEDFQWFL-FOCLMDBBSA-N |
| XLogP | 4.24 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|