C16H13N5O5 — CID 171982731
3-[(2,4-dinitrophenyl)diazenyl]-4,7-dimethyl-1H-indol-2-ol (PubChem CID 171982731) has the molecular formula C16H13N5O5 and a molecular weight of 355.31 g/mol. Its IUPAC name is 3-[(2,4-dinitrophenyl)diazenyl]-4,7-dimethyl-1H-indol-2-ol.
| Compound Name | 3-[(2,4-dinitrophenyl)diazenyl]-4,7-dimethyl-1H-indol-2-ol |
|---|---|
| PubChem CID | 171982731 |
| Molecular Formula | C16H13N5O5 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-[(2,4-dinitrophenyl)diazenyl]-4,7-dimethyl-1H-indol-2-ol |
| SMILES | Cc1ccc(C)c2c(/N=N/c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(O)[nH]c12 |
| InChI | InChI=1S/C16H13N5O5/c1-8-3-4-9(2)14-13(8)15(16(22)17-14)19-18-11-6-5-10(20(23)24)7-12(11)21(25)26/h3-7,17,22H,1-2H3/b19-18+ |
| InChIKey | HVJQHNIIRXLCTO-VHEBQXMUSA-N |
| XLogP | 4.72 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|