C22H27N5O6 — CID 59064785
ethyl 4-[4-[(2,4-dinitrophenyl)diazenyl]-N-ethyl-2,5-dimethylanilino]butanoate (PubChem CID 59064785) has the molecular formula C22H27N5O6 and a molecular weight of 457.49 g/mol. Its IUPAC name is ethyl 4-[4-[(2,4-dinitrophenyl)diazenyl]-N-ethyl-2,5-dimethylanilino]butanoate.
| Compound Name | ethyl 4-[4-[(2,4-dinitrophenyl)diazenyl]-N-ethyl-2,5-dimethylanilino]butanoate |
|---|---|
| PubChem CID | 59064785 |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl 4-[4-[(2,4-dinitrophenyl)diazenyl]-N-ethyl-2,5-dimethylanilino]butanoate |
| SMILES | CCOC(=O)CCCN(CC)c1cc(C)c(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C22H27N5O6/c1-5-25(11-7-8-22(28)33-6-2)20-13-15(3)19(12-16(20)4)24-23-18-10-9-17(26(29)30)14-21(18)27(31)32/h9-10,12-14H,5-8,11H2,1-4H3/b24-23+ |
| InChIKey | MGSOVJWVEIIPTP-WCWDXBQESA-N |
| XLogP | 5.70 |
| TPSA | 140.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|