About 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol
4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol (PubChem CID 135480221) has the molecular formula C28H29N5O5
and a molecular weight of 515.57 g/mol. Its IUPAC name is 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol.
Molecular Properties
| Compound Name | 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol |
| PubChem CID | 135480221 |
| Molecular Formula | C28H29N5O5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol |
| SMILES | CCCCN(CCCC)c1cc(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(O)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C28H29N5O5/c1-3-5-13-31(14-6-4-2)26-18-25(28(34)23-16-20-10-8-7-9-19(20)15-22(23)26)30-29-24-12-11-21(32(35)36)17-27(24)33(37)38/h7-12,15-18,34H,3-6,13-14H2,1-2H3/b30-29+ |
| InChIKey | HYRSLBDPUSNUSW-QVIHXGFCSA-N |
| XLogP | 8.34 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol?
The IUPAC name of 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol (CID 135480221) is 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol.
What is the SMILES notation for 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol?
The canonical SMILES for 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol is CCCCN(CCCC)c1cc(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(O)c2cc3ccccc3cc12.
What is the InChIKey of 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol?
The InChIKey is HYRSLBDPUSNUSW-QVIHXGFCSA-N. The full InChI is InChI=1S/C28H29N5O5/c1-3-5-13-31(14-6-4-2)26-18-25(28(34)23-16-20-10-8-7-9-19(20)15-22(23)26)30-29-24-12-11-21(32(35)36)17-27(24)33(37)38/h7-12,15-18,34H,3-6,13-14H2,1-2H3/b30-29+.
What are the key properties of 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol?
4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol has a molecular weight of 515.57 g/mol, XLogP of 8.34, 11 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibutylamino)-2-[(2,4-dinitrophenyl)diazenyl]anthracen-1-ol is sourced from PubChem (CID 135480221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).