C16H11N3O4 — CID 135503618
2-[(2-nitrophenyl)diazenyl]naphthalene-1,4-diol (PubChem CID 135503618) has the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-[(2-nitrophenyl)diazenyl]naphthalene-1,4-diol.
| Compound Name | 2-[(2-nitrophenyl)diazenyl]naphthalene-1,4-diol |
|---|---|
| PubChem CID | 135503618 |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[(2-nitrophenyl)diazenyl]naphthalene-1,4-diol |
| SMILES | O=[N+]([O-])c1ccccc1/N=N/c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C16H11N3O4/c20-15-9-13(16(21)11-6-2-1-5-10(11)15)18-17-12-7-3-4-8-14(12)19(22)23/h1-9,20-21H/b18-17+ |
| InChIKey | SNBOLSXXCCJXBO-ISLYRVAYSA-N |
| XLogP | 4.57 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|