C12H9N3O5 — CID 135986053
2-[(2-nitrophenyl)diazenyl]benzene-1,3,5-triol (PubChem CID 135986053) has the molecular formula C12H9N3O5 and a molecular weight of 275.22 g/mol. Its IUPAC name is 2-[(2-nitrophenyl)diazenyl]benzene-1,3,5-triol.
| Compound Name | 2-[(2-nitrophenyl)diazenyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 135986053 |
| Molecular Formula | C12H9N3O5 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[(2-nitrophenyl)diazenyl]benzene-1,3,5-triol |
| SMILES | O=[N+]([O-])c1ccccc1/N=N/c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C12H9N3O5/c16-7-5-10(17)12(11(18)6-7)14-13-8-3-1-2-4-9(8)15(19)20/h1-6,16-18H/b14-13+ |
| InChIKey | ZUJWWSQLRFPLTH-BUHFOSPRSA-N |
| XLogP | 3.13 |
| TPSA | 128.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|