C10H7N5O5 — CID 2754543
6-hydroxy-5-[(2-nitrophenyl)diazenyl]-1H-pyrimidine-2,4-dione (PubChem CID 2754543) has the molecular formula C10H7N5O5 and a molecular weight of 277.20 g/mol. Its IUPAC name is 6-hydroxy-5-[(2-nitrophenyl)diazenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(2-nitrophenyl)diazenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2754543 |
| Molecular Formula | C10H7N5O5 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 6-hydroxy-5-[(2-nitrophenyl)diazenyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/N=N/c2ccccc2[N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C10H7N5O5/c16-8-7(9(17)12-10(18)11-8)14-13-5-3-1-2-4-6(5)15(19)20/h1-4H,(H3,11,12,16,17,18)/b14-13+ |
| InChIKey | RRMNJNNWGYZSSX-BUHFOSPRSA-N |
| XLogP | 1.09 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|