About (2-nitrophenyl)-phenyldiazene;phenol
(2-nitrophenyl)-phenyldiazene;phenol (PubChem CID 20526289) has the molecular formula C18H15N3O3
and a molecular weight of 321.34 g/mol. Its IUPAC name is (2-nitrophenyl)-phenyldiazene;phenol.
Molecular Properties
| Compound Name | (2-nitrophenyl)-phenyldiazene;phenol |
| PubChem CID | 20526289 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (2-nitrophenyl)-phenyldiazene;phenol |
| SMILES | O=[N+]([O-])c1ccccc1/N=N/c1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C12H9N3O2.C6H6O/c16-15(17)12-9-5-4-8-11(12)14-13-10-6-2-1-3-7-10;7-6-4-2-1-3-5-6/h1-9H;1-5,7H/b14-13+; |
| InChIKey | VSAHAUDFDWJVMN-IERUDJENSA-N |
| XLogP | 5.40 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)-phenyldiazene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)-phenyldiazene;phenol?
The IUPAC name of (2-nitrophenyl)-phenyldiazene;phenol (CID 20526289) is (2-nitrophenyl)-phenyldiazene;phenol.
What is the SMILES notation for (2-nitrophenyl)-phenyldiazene;phenol?
The canonical SMILES for (2-nitrophenyl)-phenyldiazene;phenol is O=[N+]([O-])c1ccccc1/N=N/c1ccccc1.Oc1ccccc1.
What is the InChIKey of (2-nitrophenyl)-phenyldiazene;phenol?
The InChIKey is VSAHAUDFDWJVMN-IERUDJENSA-N. The full InChI is InChI=1S/C12H9N3O2.C6H6O/c16-15(17)12-9-5-4-8-11(12)14-13-10-6-2-1-3-7-10;7-6-4-2-1-3-5-6/h1-9H;1-5,7H/b14-13+;.
What are the key properties of (2-nitrophenyl)-phenyldiazene;phenol?
(2-nitrophenyl)-phenyldiazene;phenol has a molecular weight of 321.34 g/mol, XLogP of 5.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)-phenyldiazene;phenol is sourced from PubChem (CID 20526289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).