C30H29N3O2 — CID 141047377
[3,5-bis(2-phenylpropan-2-yl)phenyl]-(2-nitrophenyl)diazene (PubChem CID 141047377) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is [3,5-bis(2-phenylpropan-2-yl)phenyl]-(2-nitrophenyl)diazene.
| Compound Name | [3,5-bis(2-phenylpropan-2-yl)phenyl]-(2-nitrophenyl)diazene |
|---|---|
| PubChem CID | 141047377 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | [3,5-bis(2-phenylpropan-2-yl)phenyl]-(2-nitrophenyl)diazene |
| SMILES | CC(C)(c1ccccc1)c1cc(/N=N/c2ccccc2[N+](=O)[O-])cc(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C30H29N3O2/c1-29(2,22-13-7-5-8-14-22)24-19-25(30(3,4)23-15-9-6-10-16-23)21-26(20-24)31-32-27-17-11-12-18-28(27)33(34)35/h5-21H,1-4H3/b32-31+ |
| InChIKey | JFLFAYSQJSIJKY-QNEJGDQOSA-N |
| XLogP | 8.66 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|