C43H32N12O12 — CID 165342789
[4-[2-[4-acetyloxy-3,5-bis[(2-nitrophenyl)diazenyl]phenyl]propan-2-yl]-2,6-bis[(2-nitrophenyl)diazenyl]phenyl] acetate (PubChem CID 165342789) has the molecular formula C43H32N12O12 and a molecular weight of 908.80 g/mol. Its IUPAC name is [4-[2-[4-acetyloxy-3,5-bis[(2-nitrophenyl)diazenyl]phenyl]propan-2-yl]-2,6-bis[(2-nitrophenyl)diazenyl]phenyl] acetate.
| Compound Name | [4-[2-[4-acetyloxy-3,5-bis[(2-nitrophenyl)diazenyl]phenyl]propan-2-yl]-2,6-bis[(2-nitrophenyl)diazenyl]phenyl] acetate |
|---|---|
| PubChem CID | 165342789 |
| Molecular Formula | C43H32N12O12 |
| Molecular Weight | 908.80 g/mol |
| Exact Mass | 908.23 |
| IUPAC Name | [4-[2-[4-acetyloxy-3,5-bis[(2-nitrophenyl)diazenyl]phenyl]propan-2-yl]-2,6-bis[(2-nitrophenyl)diazenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(/N=N/c2ccccc2[N+](=O)[O-])cc(C(C)(C)c2cc(/N=N/c3ccccc3[N+](=O)[O-])c(OC(C)=O)c(/N=N/c3ccccc3[N+](=O)[O-])c2)cc1/N=N/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C43H32N12O12/c1-25(56)66-41-33(48-44-29-13-5-9-17-37(29)52(58)59)21-27(22-34(41)49-45-30-14-6-10-18-38(30)53(60)61)43(3,4)28-23-35(50-46-31-15-7-11-19-39(31)54(62)63)42(67-26(2)57)36(24-28)51-47-32-16-8-12-20-40(32)55(64)65/h5-24H,1-4H3/b48-44+,49-45+,50-46+,51-47+ |
| InChIKey | OELSIBQAZOPVFB-IVBIDMIRSA-N |
| XLogP | 13.16 |
| TPSA | 324.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.80 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|