C38H45N3O3 — CID 135980878
2-[[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenyl]diazenyl]-4,6-bis(2-phenylpropan-2-yl)phenol (PubChem CID 135980878) has the molecular formula C38H45N3O3 and a molecular weight of 591.80 g/mol. Its IUPAC name is 2-[[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenyl]diazenyl]-4,6-bis(2-phenylpropan-2-yl)phenol.
| Compound Name | 2-[[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenyl]diazenyl]-4,6-bis(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 135980878 |
| Molecular Formula | C38H45N3O3 |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.35 |
| IUPAC Name | 2-[[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenyl]diazenyl]-4,6-bis(2-phenylpropan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(/N=N/c2cc(C(C)(C)c3ccccc3)cc(C(C)(C)c3ccccc3)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C38H45N3O3/c1-35(2,3)25-36(4,5)28-20-21-31(33(24-28)41(43)44)39-40-32-23-29(37(6,7)26-16-12-10-13-17-26)22-30(34(32)42)38(8,9)27-18-14-11-15-19-27/h10-24,42H,25H2,1-9H3/b40-39+ |
| InChIKey | OKFGOHDWHBAUNQ-XQQUEIPISA-N |
| XLogP | 11.08 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|