C14H20ClNO3 — CID 28393
2-chloro-6-nitro-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 28393) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-chloro-6-nitro-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-chloro-6-nitro-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 28393 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-chloro-6-nitro-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Cl)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H20ClNO3/c1-13(2,3)8-14(4,5)9-6-10(15)12(17)11(7-9)16(18)19/h6-7,17H,8H2,1-5H3 |
| InChIKey | CMZFNWJNFPSWLL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|