C10H12ClNO4 — CID 22751542
3-(4-chloro-3-nitrophenyl)butane-1,3-diol (PubChem CID 22751542) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 3-(4-chloro-3-nitrophenyl)butane-1,3-diol.
| Compound Name | 3-(4-chloro-3-nitrophenyl)butane-1,3-diol |
|---|---|
| PubChem CID | 22751542 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-(4-chloro-3-nitrophenyl)butane-1,3-diol |
| SMILES | CC(O)(CCO)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12ClNO4/c1-10(14,4-5-13)7-2-3-8(11)9(6-7)12(15)16/h2-3,6,13-14H,4-5H2,1H3 |
| InChIKey | UZZJRPIZMUTOEO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|