C10H9ClN2O7 — CID 90826464
methyl 2-chloro-2-(4-hydroxy-3,5-dinitrophenyl)propanoate (PubChem CID 90826464) has the molecular formula C10H9ClN2O7 and a molecular weight of 304.64 g/mol. Its IUPAC name is methyl 2-chloro-2-(4-hydroxy-3,5-dinitrophenyl)propanoate.
| Compound Name | methyl 2-chloro-2-(4-hydroxy-3,5-dinitrophenyl)propanoate |
|---|---|
| PubChem CID | 90826464 |
| Molecular Formula | C10H9ClN2O7 |
| Molecular Weight | 304.64 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | methyl 2-chloro-2-(4-hydroxy-3,5-dinitrophenyl)propanoate |
| SMILES | COC(=O)C(C)(Cl)c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9ClN2O7/c1-10(11,9(15)20-2)5-3-6(12(16)17)8(14)7(4-5)13(18)19/h3-4,14H,1-2H3 |
| InChIKey | YGKAVLRWWFZZEG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|