C30H44N2O8 — CID 159114276
2,4-ditert-butyl-6-nitrophenol;(2,4-ditert-butyl-5-nitrophenyl) methyl carbonate (PubChem CID 159114276) has the molecular formula C30H44N2O8 and a molecular weight of 560.69 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-nitrophenol;(2,4-ditert-butyl-5-nitrophenyl) methyl carbonate.
| Compound Name | 2,4-ditert-butyl-6-nitrophenol;(2,4-ditert-butyl-5-nitrophenyl) methyl carbonate |
|---|---|
| PubChem CID | 159114276 |
| Molecular Formula | C30H44N2O8 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 2,4-ditert-butyl-6-nitrophenol;(2,4-ditert-butyl-5-nitrophenyl) methyl carbonate |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])c(O)c(C(C)(C)C)c1.COC(=O)Oc1cc([N+](=O)[O-])c(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C16H23NO5.C14H21NO3/c1-15(2,3)10-8-11(16(4,5)6)13(22-14(18)21-7)9-12(10)17(19)20;1-13(2,3)9-7-10(14(4,5)6)12(16)11(8-9)15(17)18/h8-9H,1-7H3;7-8,16H,1-6H3 |
| InChIKey | KEWRANPNVUJGJO-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|